About 1H-benzimidazole;zinc
1H-benzimidazole;zinc (PubChem CID 162235320) has the molecular formula C7H6N2Zn2
and a molecular weight of 248.92 g/mol. Its IUPAC name is 1H-benzimidazole;zinc.
Molecular Properties
| Compound Name | 1H-benzimidazole;zinc |
| PubChem CID | 162235320 |
| Molecular Formula | C7H6N2Zn2 |
| Molecular Weight | 248.92 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 1H-benzimidazole;zinc |
| SMILES | [Zn].[Zn].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.2Zn/c1-2-4-7-6(3-1)8-5-9-7;;/h1-5H,(H,8,9);; |
| InChIKey | ZVZDOMYBXPGXDU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.92 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;zinc?
The IUPAC name of 1H-benzimidazole;zinc (CID 162235320) is 1H-benzimidazole;zinc.
What is the SMILES notation for 1H-benzimidazole;zinc?
The canonical SMILES for 1H-benzimidazole;zinc is [Zn].[Zn].c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;zinc?
The InChIKey is ZVZDOMYBXPGXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.2Zn/c1-2-4-7-6(3-1)8-5-9-7;;/h1-5H,(H,8,9);;.
What are the key properties of 1H-benzimidazole;zinc?
1H-benzimidazole;zinc has a molecular weight of 248.92 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;zinc is sourced from PubChem (CID 162235320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).