About 1H-benzimidazole;propane;hydroiodide
1H-benzimidazole;propane;hydroiodide (PubChem CID 172791937) has the molecular formula C10H15IN2
and a molecular weight of 290.15 g/mol. Its IUPAC name is 1H-benzimidazole;propane;hydroiodide.
Molecular Properties
| Compound Name | 1H-benzimidazole;propane;hydroiodide |
| PubChem CID | 172791937 |
| Molecular Formula | C10H15IN2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1H-benzimidazole;propane;hydroiodide |
| SMILES | CCC.I.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C3H8.HI/c1-2-4-7-6(3-1)8-5-9-7;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H |
| InChIKey | VCSGISRFQZXBHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;propane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;propane;hydroiodide?
The IUPAC name of 1H-benzimidazole;propane;hydroiodide (CID 172791937) is 1H-benzimidazole;propane;hydroiodide.
What is the SMILES notation for 1H-benzimidazole;propane;hydroiodide?
The canonical SMILES for 1H-benzimidazole;propane;hydroiodide is CCC.I.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;propane;hydroiodide?
The InChIKey is VCSGISRFQZXBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C3H8.HI/c1-2-4-7-6(3-1)8-5-9-7;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H.
What are the key properties of 1H-benzimidazole;propane;hydroiodide?
1H-benzimidazole;propane;hydroiodide has a molecular weight of 290.15 g/mol, XLogP of 3.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;propane;hydroiodide is sourced from PubChem (CID 172791937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).