About bis(1H-benzimidazole);dichlorocopper
bis(1H-benzimidazole);dichlorocopper (PubChem CID 11984972) has the molecular formula C14H12Cl2CuN4
and a molecular weight of 370.73 g/mol. Its IUPAC name is bis(1H-benzimidazole);dichlorocopper.
Molecular Properties
| Compound Name | bis(1H-benzimidazole);dichlorocopper |
| PubChem CID | 11984972 |
| Molecular Formula | C14H12Cl2CuN4 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | bis(1H-benzimidazole);dichlorocopper |
| SMILES | Cl[Cu]Cl.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/2C7H6N2.2ClH.Cu/c2*1-2-4-7-6(3-1)8-5-9-7;;;/h2*1-5H,(H,8,9);2*1H;/q;;;;+2/p-2 |
| InChIKey | SVAORHNLOTVRBU-UHFFFAOYSA-L |
| XLogP | 4.50 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1H-benzimidazole);dichlorocopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-benzimidazole);dichlorocopper?
The IUPAC name of bis(1H-benzimidazole);dichlorocopper (CID 11984972) is bis(1H-benzimidazole);dichlorocopper.
What is the SMILES notation for bis(1H-benzimidazole);dichlorocopper?
The canonical SMILES for bis(1H-benzimidazole);dichlorocopper is Cl[Cu]Cl.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of bis(1H-benzimidazole);dichlorocopper?
The InChIKey is SVAORHNLOTVRBU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6N2.2ClH.Cu/c2*1-2-4-7-6(3-1)8-5-9-7;;;/h2*1-5H,(H,8,9);2*1H;/q;;;;+2/p-2.
What are the key properties of bis(1H-benzimidazole);dichlorocopper?
bis(1H-benzimidazole);dichlorocopper has a molecular weight of 370.73 g/mol, XLogP of 4.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-benzimidazole);dichlorocopper is sourced from PubChem (CID 11984972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).