About 1H-benzimidazole;bis(pyrimidine)
1H-benzimidazole;bis(pyrimidine) (PubChem CID 162103575) has the molecular formula C15H14N6
and a molecular weight of 278.32 g/mol. Its IUPAC name is 1H-benzimidazole;bis(pyrimidine).
Molecular Properties
| Compound Name | 1H-benzimidazole;bis(pyrimidine) |
| PubChem CID | 162103575 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1H-benzimidazole;bis(pyrimidine) |
| SMILES | c1ccc2[nH]cnc2c1.c1cncnc1.c1cncnc1 |
| InChI | InChI=1S/C7H6N2.2C4H4N2/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-5-4-6-3-1/h1-5H,(H,8,9);2*1-4H |
| InChIKey | ZFFCHZUIRJZOLL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-benzimidazole;bis(pyrimidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;bis(pyrimidine)?
The IUPAC name of 1H-benzimidazole;bis(pyrimidine) (CID 162103575) is 1H-benzimidazole;bis(pyrimidine).
What is the SMILES notation for 1H-benzimidazole;bis(pyrimidine)?
The canonical SMILES for 1H-benzimidazole;bis(pyrimidine) is c1ccc2[nH]cnc2c1.c1cncnc1.c1cncnc1.
What is the InChIKey of 1H-benzimidazole;bis(pyrimidine)?
The InChIKey is ZFFCHZUIRJZOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.2C4H4N2/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-5-4-6-3-1/h1-5H,(H,8,9);2*1-4H.
What are the key properties of 1H-benzimidazole;bis(pyrimidine)?
1H-benzimidazole;bis(pyrimidine) has a molecular weight of 278.32 g/mol, XLogP of 2.52, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;bis(pyrimidine) is sourced from PubChem (CID 162103575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).