About 1H-benzimidazole;piperidine;pyridine
1H-benzimidazole;piperidine;pyridine (PubChem CID 157406535) has the molecular formula C17H22N4
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1H-benzimidazole;piperidine;pyridine.
Molecular Properties
| Compound Name | 1H-benzimidazole;piperidine;pyridine |
| PubChem CID | 157406535 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1H-benzimidazole;piperidine;pyridine |
| SMILES | C1CCNCC1.c1ccc2[nH]cnc2c1.c1ccncc1 |
| InChI | InChI=1S/C7H6N2.C5H11N.C5H5N/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-4-6-5-3-1/h1-5H,(H,8,9);6H,1-5H2;1-5H |
| InChIKey | BNTYAXXHZSIVOK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazole;piperidine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;piperidine;pyridine?
The IUPAC name of 1H-benzimidazole;piperidine;pyridine (CID 157406535) is 1H-benzimidazole;piperidine;pyridine.
What is the SMILES notation for 1H-benzimidazole;piperidine;pyridine?
The canonical SMILES for 1H-benzimidazole;piperidine;pyridine is C1CCNCC1.c1ccc2[nH]cnc2c1.c1ccncc1.
What is the InChIKey of 1H-benzimidazole;piperidine;pyridine?
The InChIKey is BNTYAXXHZSIVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C5H11N.C5H5N/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-4-6-5-3-1/h1-5H,(H,8,9);6H,1-5H2;1-5H.
What are the key properties of 1H-benzimidazole;piperidine;pyridine?
1H-benzimidazole;piperidine;pyridine has a molecular weight of 282.39 g/mol, XLogP of 3.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;piperidine;pyridine is sourced from PubChem (CID 157406535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).