About 1H-benzimidazole;3-methylpiperidine
1H-benzimidazole;3-methylpiperidine (PubChem CID 158002196) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1H-benzimidazole;3-methylpiperidine.
Molecular Properties
| Compound Name | 1H-benzimidazole;3-methylpiperidine |
| PubChem CID | 158002196 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1H-benzimidazole;3-methylpiperidine |
| SMILES | CC1CCCNC1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C6H13N/c1-2-4-7-6(3-1)8-5-9-7;1-6-3-2-4-7-5-6/h1-5H,(H,8,9);6-7H,2-5H2,1H3 |
| InChIKey | FDWFBZXPXIAPHA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-benzimidazole;3-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;3-methylpiperidine?
The IUPAC name of 1H-benzimidazole;3-methylpiperidine (CID 158002196) is 1H-benzimidazole;3-methylpiperidine.
What is the SMILES notation for 1H-benzimidazole;3-methylpiperidine?
The canonical SMILES for 1H-benzimidazole;3-methylpiperidine is CC1CCCNC1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;3-methylpiperidine?
The InChIKey is FDWFBZXPXIAPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C6H13N/c1-2-4-7-6(3-1)8-5-9-7;1-6-3-2-4-7-5-6/h1-5H,(H,8,9);6-7H,2-5H2,1H3.
What are the key properties of 1H-benzimidazole;3-methylpiperidine?
1H-benzimidazole;3-methylpiperidine has a molecular weight of 217.32 g/mol, XLogP of 2.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;3-methylpiperidine is sourced from PubChem (CID 158002196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).