About acetylene;bis(1H-benzimidazole)
acetylene;bis(1H-benzimidazole) (PubChem CID 143659644) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is acetylene;bis(1H-benzimidazole).
Molecular Properties
| Compound Name | acetylene;bis(1H-benzimidazole) |
| PubChem CID | 143659644 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | acetylene;bis(1H-benzimidazole) |
| SMILES | C#C.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/2C7H6N2.C2H2/c2*1-2-4-7-6(3-1)8-5-9-7;1-2/h2*1-5H,(H,8,9);1-2H |
| InChIKey | SVVYSKKVPDPXMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;bis(1H-benzimidazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;bis(1H-benzimidazole)?
The IUPAC name of acetylene;bis(1H-benzimidazole) (CID 143659644) is acetylene;bis(1H-benzimidazole).
What is the SMILES notation for acetylene;bis(1H-benzimidazole)?
The canonical SMILES for acetylene;bis(1H-benzimidazole) is C#C.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of acetylene;bis(1H-benzimidazole)?
The InChIKey is SVVYSKKVPDPXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6N2.C2H2/c2*1-2-4-7-6(3-1)8-5-9-7;1-2/h2*1-5H,(H,8,9);1-2H.
What are the key properties of acetylene;bis(1H-benzimidazole)?
acetylene;bis(1H-benzimidazole) has a molecular weight of 262.32 g/mol, XLogP of 3.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;bis(1H-benzimidazole) is sourced from PubChem (CID 143659644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).