About 1H-benzimidazole;ethane;molecular hydrogen
1H-benzimidazole;ethane;molecular hydrogen (PubChem CID 142113314) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1H-benzimidazole;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 1H-benzimidazole;ethane;molecular hydrogen |
| PubChem CID | 142113314 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1H-benzimidazole;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C2H6.H2/c1-2-4-7-6(3-1)8-5-9-7;1-2;/h1-5H,(H,8,9);1-2H3;1H |
| InChIKey | XEPDENOVXNRCFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzimidazole;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;ethane;molecular hydrogen?
The IUPAC name of 1H-benzimidazole;ethane;molecular hydrogen (CID 142113314) is 1H-benzimidazole;ethane;molecular hydrogen.
What is the SMILES notation for 1H-benzimidazole;ethane;molecular hydrogen?
The canonical SMILES for 1H-benzimidazole;ethane;molecular hydrogen is CC.[H][H].c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;ethane;molecular hydrogen?
The InChIKey is XEPDENOVXNRCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H6.H2/c1-2-4-7-6(3-1)8-5-9-7;1-2;/h1-5H,(H,8,9);1-2H3;1H.
What are the key properties of 1H-benzimidazole;ethane;molecular hydrogen?
1H-benzimidazole;ethane;molecular hydrogen has a molecular weight of 150.22 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;ethane;molecular hydrogen is sourced from PubChem (CID 142113314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).