About 1-aminoethanol;1H-benzimidazole
1-aminoethanol;1H-benzimidazole (PubChem CID 158188844) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-aminoethanol;1H-benzimidazole.
Molecular Properties
| Compound Name | 1-aminoethanol;1H-benzimidazole |
| PubChem CID | 158188844 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-aminoethanol;1H-benzimidazole |
| SMILES | CC(N)O.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C2H7NO/c1-2-4-7-6(3-1)8-5-9-7;1-2(3)4/h1-5H,(H,8,9);2,4H,3H2,1H3 |
| InChIKey | FZMJZMIRAXWONV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanol;1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanol;1H-benzimidazole?
The IUPAC name of 1-aminoethanol;1H-benzimidazole (CID 158188844) is 1-aminoethanol;1H-benzimidazole.
What is the SMILES notation for 1-aminoethanol;1H-benzimidazole?
The canonical SMILES for 1-aminoethanol;1H-benzimidazole is CC(N)O.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1-aminoethanol;1H-benzimidazole?
The InChIKey is FZMJZMIRAXWONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H7NO/c1-2-4-7-6(3-1)8-5-9-7;1-2(3)4/h1-5H,(H,8,9);2,4H,3H2,1H3.
What are the key properties of 1-aminoethanol;1H-benzimidazole?
1-aminoethanol;1H-benzimidazole has a molecular weight of 179.22 g/mol, XLogP of 0.85, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanol;1H-benzimidazole is sourced from PubChem (CID 158188844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).