About 1H-benzimidazole;methyl carbamate
1H-benzimidazole;methyl carbamate (PubChem CID 18504441) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1H-benzimidazole;methyl carbamate.
Molecular Properties
| Compound Name | 1H-benzimidazole;methyl carbamate |
| PubChem CID | 18504441 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1H-benzimidazole;methyl carbamate |
| SMILES | COC(N)=O.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C2H5NO2/c1-2-4-7-6(3-1)8-5-9-7;1-5-2(3)4/h1-5H,(H,8,9);1H3,(H2,3,4) |
| InChIKey | URANHGZOFVYVJV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazole;methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;methyl carbamate?
The IUPAC name of 1H-benzimidazole;methyl carbamate (CID 18504441) is 1H-benzimidazole;methyl carbamate.
What is the SMILES notation for 1H-benzimidazole;methyl carbamate?
The canonical SMILES for 1H-benzimidazole;methyl carbamate is COC(N)=O.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;methyl carbamate?
The InChIKey is URANHGZOFVYVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H5NO2/c1-2-4-7-6(3-1)8-5-9-7;1-5-2(3)4/h1-5H,(H,8,9);1H3,(H2,3,4).
What are the key properties of 1H-benzimidazole;methyl carbamate?
1H-benzimidazole;methyl carbamate has a molecular weight of 193.21 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;methyl carbamate is sourced from PubChem (CID 18504441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).