About sodium;1H-benzimidazole;2-hydroxypropanoate
sodium;1H-benzimidazole;2-hydroxypropanoate (PubChem CID 175014007) has the molecular formula C10H11N2NaO3
and a molecular weight of 230.20 g/mol. Its IUPAC name is sodium;1H-benzimidazole;2-hydroxypropanoate.
Molecular Properties
| Compound Name | sodium;1H-benzimidazole;2-hydroxypropanoate |
| PubChem CID | 175014007 |
| Molecular Formula | C10H11N2NaO3 |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | sodium;1H-benzimidazole;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].[Na+].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C3H6O3.Na/c1-2-4-7-6(3-1)8-5-9-7;1-2(4)3(5)6;/h1-5H,(H,8,9);2,4H,1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | LBJRBICVMUBYSQ-UHFFFAOYSA-M |
| XLogP | -3.32 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;1H-benzimidazole;2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1H-benzimidazole;2-hydroxypropanoate?
The IUPAC name of sodium;1H-benzimidazole;2-hydroxypropanoate (CID 175014007) is sodium;1H-benzimidazole;2-hydroxypropanoate.
What is the SMILES notation for sodium;1H-benzimidazole;2-hydroxypropanoate?
The canonical SMILES for sodium;1H-benzimidazole;2-hydroxypropanoate is CC(O)C(=O)[O-].[Na+].c1ccc2[nH]cnc2c1.
What is the InChIKey of sodium;1H-benzimidazole;2-hydroxypropanoate?
The InChIKey is LBJRBICVMUBYSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2.C3H6O3.Na/c1-2-4-7-6(3-1)8-5-9-7;1-2(4)3(5)6;/h1-5H,(H,8,9);2,4H,1H3,(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;1H-benzimidazole;2-hydroxypropanoate?
sodium;1H-benzimidazole;2-hydroxypropanoate has a molecular weight of 230.20 g/mol, XLogP of -3.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1H-benzimidazole;2-hydroxypropanoate is sourced from PubChem (CID 175014007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).