About bis(1H-benzimidazole);hydrochloride
bis(1H-benzimidazole);hydrochloride (PubChem CID 163717509) has the molecular formula C14H13ClN4
and a molecular weight of 272.74 g/mol. Its IUPAC name is bis(1H-benzimidazole);hydrochloride.
Molecular Properties
| Compound Name | bis(1H-benzimidazole);hydrochloride |
| PubChem CID | 163717509 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | bis(1H-benzimidazole);hydrochloride |
| SMILES | Cl.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/2C7H6N2.ClH/c2*1-2-4-7-6(3-1)8-5-9-7;/h2*1-5H,(H,8,9);1H |
| InChIKey | KOQUMOUKYMMUTO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1H-benzimidazole);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-benzimidazole);hydrochloride?
The IUPAC name of bis(1H-benzimidazole);hydrochloride (CID 163717509) is bis(1H-benzimidazole);hydrochloride.
What is the SMILES notation for bis(1H-benzimidazole);hydrochloride?
The canonical SMILES for bis(1H-benzimidazole);hydrochloride is Cl.c1ccc2[nH]cnc2c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of bis(1H-benzimidazole);hydrochloride?
The InChIKey is KOQUMOUKYMMUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6N2.ClH/c2*1-2-4-7-6(3-1)8-5-9-7;/h2*1-5H,(H,8,9);1H.
What are the key properties of bis(1H-benzimidazole);hydrochloride?
bis(1H-benzimidazole);hydrochloride has a molecular weight of 272.74 g/mol, XLogP of 3.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-benzimidazole);hydrochloride is sourced from PubChem (CID 163717509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).