About 1H-benzimidazole;cyclopropene
1H-benzimidazole;cyclopropene (PubChem CID 175111337) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1H-benzimidazole;cyclopropene.
Molecular Properties
| Compound Name | 1H-benzimidazole;cyclopropene |
| PubChem CID | 175111337 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 1H-benzimidazole;cyclopropene |
| SMILES | C1=CC1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C3H4/c1-2-4-7-6(3-1)8-5-9-7;1-2-3-1/h1-5H,(H,8,9);1-2H,3H2 |
| InChIKey | JWHYBXZVVCTZNZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;cyclopropene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;cyclopropene?
The IUPAC name of 1H-benzimidazole;cyclopropene (CID 175111337) is 1H-benzimidazole;cyclopropene.
What is the SMILES notation for 1H-benzimidazole;cyclopropene?
The canonical SMILES for 1H-benzimidazole;cyclopropene is C1=CC1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;cyclopropene?
The InChIKey is JWHYBXZVVCTZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C3H4/c1-2-4-7-6(3-1)8-5-9-7;1-2-3-1/h1-5H,(H,8,9);1-2H,3H2.
What are the key properties of 1H-benzimidazole;cyclopropene?
1H-benzimidazole;cyclopropene has a molecular weight of 158.20 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;cyclopropene is sourced from PubChem (CID 175111337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).