About 1H-benzimidazole;1,2-diphenylbenzene
1H-benzimidazole;1,2-diphenylbenzene (PubChem CID 174973053) has the molecular formula C25H20N2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 1H-benzimidazole;1,2-diphenylbenzene.
Molecular Properties
| Compound Name | 1H-benzimidazole;1,2-diphenylbenzene |
| PubChem CID | 174973053 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1H-benzimidazole;1,2-diphenylbenzene |
| SMILES | c1ccc(-c2ccccc2-c2ccccc2)cc1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C18H14.C7H6N2/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)16-11-5-2-6-12-16;1-2-4-7-6(3-1)8-5-9-7/h1-14H;1-5H,(H,8,9) |
| InChIKey | MUOQHSTYONYJQQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzimidazole;1,2-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;1,2-diphenylbenzene?
The IUPAC name of 1H-benzimidazole;1,2-diphenylbenzene (CID 174973053) is 1H-benzimidazole;1,2-diphenylbenzene.
What is the SMILES notation for 1H-benzimidazole;1,2-diphenylbenzene?
The canonical SMILES for 1H-benzimidazole;1,2-diphenylbenzene is c1ccc(-c2ccccc2-c2ccccc2)cc1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;1,2-diphenylbenzene?
The InChIKey is MUOQHSTYONYJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.C7H6N2/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)16-11-5-2-6-12-16;1-2-4-7-6(3-1)8-5-9-7/h1-14H;1-5H,(H,8,9).
What are the key properties of 1H-benzimidazole;1,2-diphenylbenzene?
1H-benzimidazole;1,2-diphenylbenzene has a molecular weight of 348.45 g/mol, XLogP of 6.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;1,2-diphenylbenzene is sourced from PubChem (CID 174973053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).