C25H20N2 — CID 174973053
1H-benzimidazole;1,2-diphenylbenzene (PubChem CID 174973053) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1H-benzimidazole;1,2-diphenylbenzene.
| Compound Name | 1H-benzimidazole;1,2-diphenylbenzene |
|---|---|
| PubChem CID | 174973053 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1H-benzimidazole;1,2-diphenylbenzene |
| SMILES | c1ccc(-c2ccccc2-c2ccccc2)cc1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C18H14.C7H6N2/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)16-11-5-2-6-12-16;1-2-4-7-6(3-1)8-5-9-7/h1-14H;1-5H,(H,8,9) |
| InChIKey | MUOQHSTYONYJQQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |