About 1H-benzimidazole;2-phenylbenzenecarboximidamide
1H-benzimidazole;2-phenylbenzenecarboximidamide (PubChem CID 158117325) has the molecular formula C20H18N4
and a molecular weight of 314.39 g/mol. Its IUPAC name is 1H-benzimidazole;2-phenylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 1H-benzimidazole;2-phenylbenzenecarboximidamide |
| PubChem CID | 158117325 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1H-benzimidazole;2-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1-c1ccccc1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C13H12N2.C7H6N2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-4-7-6(3-1)8-5-9-7/h1-9H,(H3,14,15);1-5H,(H,8,9) |
| InChIKey | FRECIVQPCHCFEP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;2-phenylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;2-phenylbenzenecarboximidamide?
The IUPAC name of 1H-benzimidazole;2-phenylbenzenecarboximidamide (CID 158117325) is 1H-benzimidazole;2-phenylbenzenecarboximidamide.
What is the SMILES notation for 1H-benzimidazole;2-phenylbenzenecarboximidamide?
The canonical SMILES for 1H-benzimidazole;2-phenylbenzenecarboximidamide is [H]/N=C(\N)c1ccccc1-c1ccccc1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;2-phenylbenzenecarboximidamide?
The InChIKey is FRECIVQPCHCFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.C7H6N2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-4-7-6(3-1)8-5-9-7/h1-9H,(H3,14,15);1-5H,(H,8,9).
What are the key properties of 1H-benzimidazole;2-phenylbenzenecarboximidamide?
1H-benzimidazole;2-phenylbenzenecarboximidamide has a molecular weight of 314.39 g/mol, XLogP of 4.20, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;2-phenylbenzenecarboximidamide is sourced from PubChem (CID 158117325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).