C12H15NS — CID 142928032
5-pentan-3-yl-1,3-benzothiazole (PubChem CID 142928032) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-pentan-3-yl-1,3-benzothiazole.
| Compound Name | 5-pentan-3-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 142928032 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-pentan-3-yl-1,3-benzothiazole |
| SMILES | CCC(CC)c1ccc2scnc2c1 |
| InChI | InChI=1S/C12H15NS/c1-3-9(4-2)10-5-6-12-11(7-10)13-8-14-12/h5-9H,3-4H2,1-2H3 |
| InChIKey | BHDXGFPDTHAROM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |