C13H19Cl2N3S — CID 127264088
5-(1-piperazin-1-ylethyl)-1,3-benzothiazole;dihydrochloride (PubChem CID 127264088) has the molecular formula C13H19Cl2N3S and a molecular weight of 320.29 g/mol. Its IUPAC name is 5-(1-piperazin-1-ylethyl)-1,3-benzothiazole;dihydrochloride.
| Compound Name | 5-(1-piperazin-1-ylethyl)-1,3-benzothiazole;dihydrochloride |
|---|---|
| PubChem CID | 127264088 |
| Molecular Formula | C13H19Cl2N3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-(1-piperazin-1-ylethyl)-1,3-benzothiazole;dihydrochloride |
| SMILES | CC(c1ccc2scnc2c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H17N3S.2ClH/c1-10(16-6-4-14-5-7-16)11-2-3-13-12(8-11)15-9-17-13;;/h2-3,8-10,14H,4-7H2,1H3;2*1H |
| InChIKey | JOFYFLNRLWDDKF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |