C19H23N5OS2 — CID 161239383
[2-[4-[1-(1,3-benzothiazol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]-methyl-methylidene-oxo-λ6-sulfane (PubChem CID 161239383) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is [2-[4-[1-(1,3-benzothiazol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]-methyl-methylidene-oxo-λ6-sulfane.
| Compound Name | [2-[4-[1-(1,3-benzothiazol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]-methyl-methylidene-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 161239383 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [2-[4-[1-(1,3-benzothiazol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]-methyl-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(C)(=O)c1cnc(N2CCN(C(C)c3ccc4scnc4c3)CC2)nc1 |
| InChI | InChI=1S/C19H23N5OS2/c1-14(15-4-5-18-17(10-15)22-13-26-18)23-6-8-24(9-7-23)19-20-11-16(12-21-19)27(2,3)25/h4-5,10-14H,2,6-9H2,1,3H3 |
| InChIKey | PLLWJWBSXVPEGY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|