C13H15NO2S — CID 18613621
2-(1,3-benzothiazol-5-yl)-3,3-dimethylbutanoic acid (PubChem CID 18613621) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-5-yl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(1,3-benzothiazol-5-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 18613621 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-(1,3-benzothiazol-5-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)c1ccc2scnc2c1 |
| InChI | InChI=1S/C13H15NO2S/c1-13(2,3)11(12(15)16)8-4-5-10-9(6-8)14-7-17-10/h4-7,11H,1-3H3,(H,15,16) |
| InChIKey | IBMZAEDZHQWCCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |