C12H15BrO2 — CID 67987841
2-(4-bromophenyl)-3,3-dimethylbutanoic acid (PubChem CID 67987841) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(4-bromophenyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67987841 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(4-bromophenyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrO2/c1-12(2,3)10(11(14)15)8-4-6-9(13)7-5-8/h4-7,10H,1-3H3,(H,14,15) |
| InChIKey | OCQXMGDWMDRZPL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |