C16H24N2O2S — CID 167496380
1,3-benzothiazol-5-ylmethanamine;5,5-dimethylhexanoic acid (PubChem CID 167496380) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 1,3-benzothiazol-5-ylmethanamine;5,5-dimethylhexanoic acid.
| Compound Name | 1,3-benzothiazol-5-ylmethanamine;5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496380 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1,3-benzothiazol-5-ylmethanamine;5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCCC(=O)O.NCc1ccc2scnc2c1 |
| InChI | InChI=1S/C8H8N2S.C8H16O2/c9-4-6-1-2-8-7(3-6)10-5-11-8;1-8(2,3)6-4-5-7(9)10/h1-3,5H,4,9H2;4-6H2,1-3H3,(H,9,10) |
| InChIKey | ZMVBSSWFIXDMJU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |