(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid

C17H29NO4 — CID 167496524

IUPAC(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid
SMILESCC(C)(C)CCCC(=O)O.COc1cc(CN)cc(OC)c1
InChIInChI=1S/C9H13NO2.C8H16O2/c1-11-8-3-7(6-10)4-9(5-8)12-2;1-8(2,3)6-4-5-7(9)10/h3-5H,6,10H2,1-2H3;4-6H2,1-3H3,(H,9,10)
InChIKeyTYRODIRSYRIBSU-UHFFFAOYSA-N
MW311.42 g/mol
LogP3.45
Rot. Bonds6

About (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid

(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid (PubChem CID 167496524) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid.

Molecular Properties

Compound Name(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid
PubChem CID167496524
Molecular FormulaC17H29NO4
Molecular Weight311.42 g/mol
Exact Mass311.21
IUPAC Name(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid
SMILESCC(C)(C)CCCC(=O)O.COc1cc(CN)cc(OC)c1
InChIInChI=1S/C9H13NO2.C8H16O2/c1-11-8-3-7(6-10)4-9(5-8)12-2;1-8(2,3)6-4-5-7(9)10/h3-5H,6,10H2,1-2H3;4-6H2,1-3H3,(H,9,10)
InChIKeyTYRODIRSYRIBSU-UHFFFAOYSA-N
XLogP3.45
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.42
LogP ≤ 53.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid?
The IUPAC name of (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid (CID 167496524) is (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid.
What is the SMILES notation for (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid?
The canonical SMILES for (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid is CC(C)(C)CCCC(=O)O.COc1cc(CN)cc(OC)c1.
What is the InChIKey of (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid?
The InChIKey is TYRODIRSYRIBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2.C8H16O2/c1-11-8-3-7(6-10)4-9(5-8)12-2;1-8(2,3)6-4-5-7(9)10/h3-5H,6,10H2,1-2H3;4-6H2,1-3H3,(H,9,10).
What are the key properties of (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid?
(3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid has a molecular weight of 311.42 g/mol, XLogP of 3.45, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid is sourced from PubChem (CID 167496524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).