C17H29NO4 — CID 167496510
(2,3-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid (PubChem CID 167496510) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid.
| Compound Name | (2,3-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496510 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (2,3-dimethoxyphenyl)methanamine;5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCCC(=O)O.COc1cccc(CN)c1OC |
| InChI | InChI=1S/C9H13NO2.C8H16O2/c1-11-8-5-3-4-7(6-10)9(8)12-2;1-8(2,3)6-4-5-7(9)10/h3-5H,6,10H2,1-2H3;4-6H2,1-3H3,(H,9,10) |
| InChIKey | YMXLFUZZCWMIRZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |