C17H29NO3 — CID 167496368
5,5-dimethylhexanoic acid;(3-methoxy-4-methylphenyl)methanamine (PubChem CID 167496368) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 5,5-dimethylhexanoic acid;(3-methoxy-4-methylphenyl)methanamine.
| Compound Name | 5,5-dimethylhexanoic acid;(3-methoxy-4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 167496368 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 5,5-dimethylhexanoic acid;(3-methoxy-4-methylphenyl)methanamine |
| SMILES | CC(C)(C)CCCC(=O)O.COc1cc(CN)ccc1C |
| InChI | InChI=1S/C9H13NO.C8H16O2/c1-7-3-4-8(6-10)5-9(7)11-2;1-8(2,3)6-4-5-7(9)10/h3-5H,6,10H2,1-2H3;4-6H2,1-3H3,(H,9,10) |
| InChIKey | HMTJHWLBBFOKLO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |