C20H28N2O3 — CID 170973974
5,5-dimethylhexanoic acid;(6-phenoxy-3-pyridinyl)methanamine (PubChem CID 170973974) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5,5-dimethylhexanoic acid;(6-phenoxy-3-pyridinyl)methanamine.
| Compound Name | 5,5-dimethylhexanoic acid;(6-phenoxy-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 170973974 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5,5-dimethylhexanoic acid;(6-phenoxy-3-pyridinyl)methanamine |
| SMILES | CC(C)(C)CCCC(=O)O.NCc1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C12H12N2O.C8H16O2/c13-8-10-6-7-12(14-9-10)15-11-4-2-1-3-5-11;1-8(2,3)6-4-5-7(9)10/h1-7,9H,8,13H2;4-6H2,1-3H3,(H,9,10) |
| InChIKey | GCYGQODGZONJTO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |