C24H25NO5 — CID 59820366
2-[3-butoxy-5-[(6-phenoxy-3-pyridinyl)methoxy]phenyl]acetic acid (PubChem CID 59820366) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[3-butoxy-5-[(6-phenoxy-3-pyridinyl)methoxy]phenyl]acetic acid.
| Compound Name | 2-[3-butoxy-5-[(6-phenoxy-3-pyridinyl)methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59820366 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[3-butoxy-5-[(6-phenoxy-3-pyridinyl)methoxy]phenyl]acetic acid |
| SMILES | CCCCOc1cc(CC(=O)O)cc(OCc2ccc(Oc3ccccc3)nc2)c1 |
| InChI | InChI=1S/C24H25NO5/c1-2-3-11-28-21-12-19(14-24(26)27)13-22(15-21)29-17-18-9-10-23(25-16-18)30-20-7-5-4-6-8-20/h4-10,12-13,15-16H,2-3,11,14,17H2,1H3,(H,26,27) |
| InChIKey | QBISJBHUYALDDV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|