C27H28O5 — CID 141320094
2-[2-pentanoyl-3,5-bis(phenylmethoxy)phenyl]acetic acid (PubChem CID 141320094) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[2-pentanoyl-3,5-bis(phenylmethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-pentanoyl-3,5-bis(phenylmethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 141320094 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-[2-pentanoyl-3,5-bis(phenylmethoxy)phenyl]acetic acid |
| SMILES | CCCCC(=O)c1c(CC(=O)O)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O5/c1-2-3-14-24(28)27-22(16-26(29)30)15-23(31-18-20-10-6-4-7-11-20)17-25(27)32-19-21-12-8-5-9-13-21/h4-13,15,17H,2-3,14,16,18-19H2,1H3,(H,29,30) |
| InChIKey | JYWXROJXPJNZCV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |