C24H30O4 — CID 141184822
2-(2-nonanoyl-3-phenylmethoxyphenyl)acetic acid (PubChem CID 141184822) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-(2-nonanoyl-3-phenylmethoxyphenyl)acetic acid.
| Compound Name | 2-(2-nonanoyl-3-phenylmethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 141184822 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-(2-nonanoyl-3-phenylmethoxyphenyl)acetic acid |
| SMILES | CCCCCCCCC(=O)c1c(CC(=O)O)cccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H30O4/c1-2-3-4-5-6-10-15-21(25)24-20(17-23(26)27)14-11-16-22(24)28-18-19-12-8-7-9-13-19/h7-9,11-14,16H,2-6,10,15,17-18H2,1H3,(H,26,27) |
| InChIKey | AWVNREPQGJFXSS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|