C40H46O6 — CID 141184839
ethyl 2-[2-nonanoyl-3,4,5-tris(phenylmethoxy)phenyl]acetate (PubChem CID 141184839) has the molecular formula C40H46O6 and a molecular weight of 622.80 g/mol. Its IUPAC name is ethyl 2-[2-nonanoyl-3,4,5-tris(phenylmethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[2-nonanoyl-3,4,5-tris(phenylmethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 141184839 |
| Molecular Formula | C40H46O6 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | ethyl 2-[2-nonanoyl-3,4,5-tris(phenylmethoxy)phenyl]acetate |
| SMILES | CCCCCCCCC(=O)c1c(CC(=O)OCC)cc(OCc2ccccc2)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C40H46O6/c1-3-5-6-7-8-18-25-35(41)38-34(27-37(42)43-4-2)26-36(44-28-31-19-12-9-13-20-31)39(45-29-32-21-14-10-15-22-32)40(38)46-30-33-23-16-11-17-24-33/h9-17,19-24,26H,3-8,18,25,27-30H2,1-2H3 |
| InChIKey | YAMNEKQPPAFXPN-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|