C24H30O4 — CID 141184811
pentyl 2-(2-butanoyl-4-phenylmethoxyphenyl)acetate (PubChem CID 141184811) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is pentyl 2-(2-butanoyl-4-phenylmethoxyphenyl)acetate.
| Compound Name | pentyl 2-(2-butanoyl-4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 141184811 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | pentyl 2-(2-butanoyl-4-phenylmethoxyphenyl)acetate |
| SMILES | CCCCCOC(=O)Cc1ccc(OCc2ccccc2)cc1C(=O)CCC |
| InChI | InChI=1S/C24H30O4/c1-3-5-9-15-27-24(26)16-20-13-14-21(17-22(20)23(25)10-4-2)28-18-19-11-7-6-8-12-19/h6-8,11-14,17H,3-5,9-10,15-16,18H2,1-2H3 |
| InChIKey | UGFQULBXEZCDPX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|