C62H64O6 — CID 20754102
1-[2-[6-(2-heptanoyl-4-phenylmethoxyphenyl)-5-hexa-1,3,5-triynoxy-1-hexoxynaphthalen-2-yl]-5-phenylmethoxyphenyl]heptan-1-one (PubChem CID 20754102) has the molecular formula C62H64O6 and a molecular weight of 905.19 g/mol. Its IUPAC name is 1-[2-[6-(2-heptanoyl-4-phenylmethoxyphenyl)-5-hexa-1,3,5-triynoxy-1-hexoxynaphthalen-2-yl]-5-phenylmethoxyphenyl]heptan-1-one.
| Compound Name | 1-[2-[6-(2-heptanoyl-4-phenylmethoxyphenyl)-5-hexa-1,3,5-triynoxy-1-hexoxynaphthalen-2-yl]-5-phenylmethoxyphenyl]heptan-1-one |
|---|---|
| PubChem CID | 20754102 |
| Molecular Formula | C62H64O6 |
| Molecular Weight | 905.19 g/mol |
| Exact Mass | 904.47 |
| IUPAC Name | 1-[2-[6-(2-heptanoyl-4-phenylmethoxyphenyl)-5-hexa-1,3,5-triynoxy-1-hexoxynaphthalen-2-yl]-5-phenylmethoxyphenyl]heptan-1-one |
| SMILES | C#CC#CC#COc1c(-c2ccc(OCc3ccccc3)cc2C(=O)CCCCCC)ccc2c(OCCCCCC)c(-c3ccc(OCc4ccccc4)cc3C(=O)CCCCCC)ccc12 |
| InChI | InChI=1S/C62H64O6/c1-5-9-13-23-31-59(63)57-43-49(67-45-47-27-19-17-20-28-47)33-35-51(57)53-37-39-56-55(61(53)65-41-25-15-11-7-3)40-38-54(62(56)66-42-26-16-12-8-4)52-36-34-50(68-46-48-29-21-18-22-30-48)44-58(52)60(64)32-24-14-10-6-2/h3,17-22,27-30,33-40,43-44H,5-6,8-10,12-14,16,23-24,26,31-32,42,45-46H2,1-2,4H3 |
| InChIKey | QCWLBYPXQVLCNK-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.19 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|