C21H26O2 — CID 83937135
1-(2-methyl-4-phenylmethoxyphenyl)heptan-4-one (PubChem CID 83937135) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-(2-methyl-4-phenylmethoxyphenyl)heptan-4-one.
| Compound Name | 1-(2-methyl-4-phenylmethoxyphenyl)heptan-4-one |
|---|---|
| PubChem CID | 83937135 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-(2-methyl-4-phenylmethoxyphenyl)heptan-4-one |
| SMILES | CCCC(=O)CCCc1ccc(OCc2ccccc2)cc1C |
| InChI | InChI=1S/C21H26O2/c1-3-8-20(22)12-7-11-19-13-14-21(15-17(19)2)23-16-18-9-5-4-6-10-18/h4-6,9-10,13-15H,3,7-8,11-12,16H2,1-2H3 |
| InChIKey | GVKHMUKRAVDCFM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |