C17H26O3 — CID 83942828
1-(2,5-diethoxyphenyl)heptan-4-one (PubChem CID 83942828) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)heptan-4-one.
| Compound Name | 1-(2,5-diethoxyphenyl)heptan-4-one |
|---|---|
| PubChem CID | 83942828 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)heptan-4-one |
| SMILES | CCCC(=O)CCCc1cc(OCC)ccc1OCC |
| InChI | InChI=1S/C17H26O3/c1-4-8-15(18)10-7-9-14-13-16(19-5-2)11-12-17(14)20-6-3/h11-13H,4-10H2,1-3H3 |
| InChIKey | DALSVHMBSZSXSU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |