C26H26O6 — CID 10741488
ethyl 3-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-3-oxopropanoate (PubChem CID 10741488) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is ethyl 3-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 10741488 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | ethyl 3-[4-methoxy-3,5-bis(phenylmethoxy)phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(OCc2ccccc2)c(OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H26O6/c1-3-30-25(28)16-22(27)21-14-23(31-17-19-10-6-4-7-11-19)26(29-2)24(15-21)32-18-20-12-8-5-9-13-20/h4-15H,3,16-18H2,1-2H3 |
| InChIKey | SMPALJUDYZQPCP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|