C26H26O8 — CID 24750378
1-(3,4-dimethoxy-5-phenylmethoxyphenyl)-3-(2-hydroxy-3,4-dimethoxyphenyl)propane-1,3-dione (PubChem CID 24750378) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-5-phenylmethoxyphenyl)-3-(2-hydroxy-3,4-dimethoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(3,4-dimethoxy-5-phenylmethoxyphenyl)-3-(2-hydroxy-3,4-dimethoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 24750378 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-(3,4-dimethoxy-5-phenylmethoxyphenyl)-3-(2-hydroxy-3,4-dimethoxyphenyl)propane-1,3-dione |
| SMILES | COc1cc(C(=O)CC(=O)c2ccc(OC)c(OC)c2O)cc(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C26H26O8/c1-30-21-11-10-18(24(29)26(21)33-4)20(28)14-19(27)17-12-22(31-2)25(32-3)23(13-17)34-15-16-8-6-5-7-9-16/h5-13,29H,14-15H2,1-4H3 |
| InChIKey | HSXJWJYFYOLGJK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|