C32H30O8 — CID 10119740
1-[3,4-bis(phenylmethoxy)phenyl]-3-(6-hydroxy-2,3,4-trimethoxyphenyl)propane-1,3-dione (PubChem CID 10119740) has the molecular formula C32H30O8 and a molecular weight of 542.58 g/mol. Its IUPAC name is 1-[3,4-bis(phenylmethoxy)phenyl]-3-(6-hydroxy-2,3,4-trimethoxyphenyl)propane-1,3-dione.
| Compound Name | 1-[3,4-bis(phenylmethoxy)phenyl]-3-(6-hydroxy-2,3,4-trimethoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10119740 |
| Molecular Formula | C32H30O8 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 1-[3,4-bis(phenylmethoxy)phenyl]-3-(6-hydroxy-2,3,4-trimethoxyphenyl)propane-1,3-dione |
| SMILES | COc1cc(O)c(C(=O)CC(=O)c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)c(OC)c1OC |
| InChI | InChI=1S/C32H30O8/c1-36-29-18-26(35)30(32(38-3)31(29)37-2)25(34)17-24(33)23-14-15-27(39-19-21-10-6-4-7-11-21)28(16-23)40-20-22-12-8-5-9-13-22/h4-16,18,35H,17,19-20H2,1-3H3 |
| InChIKey | YNRHKZGLQKAXGM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|