C32H38O6 — CID 150939552
2-(10-hydroxy-6-oxoundecyl)-4,6-bis(phenylmethoxy)benzoic acid (PubChem CID 150939552) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-(10-hydroxy-6-oxoundecyl)-4,6-bis(phenylmethoxy)benzoic acid.
| Compound Name | 2-(10-hydroxy-6-oxoundecyl)-4,6-bis(phenylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 150939552 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 2-(10-hydroxy-6-oxoundecyl)-4,6-bis(phenylmethoxy)benzoic acid |
| SMILES | CC(O)CCCC(=O)CCCCCc1cc(OCc2ccccc2)cc(OCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C32H38O6/c1-24(33)12-11-19-28(34)18-10-4-9-17-27-20-29(37-22-25-13-5-2-6-14-25)21-30(31(27)32(35)36)38-23-26-15-7-3-8-16-26/h2-3,5-8,13-16,20-21,24,33H,4,9-12,17-19,22-23H2,1H3,(H,35,36) |
| InChIKey | LHTIZCAOVQCWAO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|