C34H40O7 — CID 86734265
2-[(E)-5-[3-[(3R)-3-hydroxybutyl]-1,4-dioxan-2-yl]pent-1-enyl]-4,6-bis(phenylmethoxy)benzoic acid (PubChem CID 86734265) has the molecular formula C34H40O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[(E)-5-[3-[(3R)-3-hydroxybutyl]-1,4-dioxan-2-yl]pent-1-enyl]-4,6-bis(phenylmethoxy)benzoic acid.
| Compound Name | 2-[(E)-5-[3-[(3R)-3-hydroxybutyl]-1,4-dioxan-2-yl]pent-1-enyl]-4,6-bis(phenylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 86734265 |
| Molecular Formula | C34H40O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[(E)-5-[3-[(3R)-3-hydroxybutyl]-1,4-dioxan-2-yl]pent-1-enyl]-4,6-bis(phenylmethoxy)benzoic acid |
| SMILES | C[C@@H](O)CCC1OCCOC1CCC/C=C/c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C34H40O7/c1-25(35)17-18-31-30(38-19-20-39-31)16-10-4-9-15-28-21-29(40-23-26-11-5-2-6-12-26)22-32(33(28)34(36)37)41-24-27-13-7-3-8-14-27/h2-3,5-9,11-15,21-22,25,30-31,35H,4,10,16-20,23-24H2,1H3,(H,36,37)/b15-9+/t25-,30?,31?/m1/s1 |
| InChIKey | COHURBIMZURVGR-TZKNCAGGSA-N |
| XLogP | 6.67 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|