C32H34O5 — CID 11364022
[(2S)-hept-6-en-2-yl] 2-(2-oxobut-3-enyl)-4,6-bis(phenylmethoxy)benzoate (PubChem CID 11364022) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(2S)-hept-6-en-2-yl] 2-(2-oxobut-3-enyl)-4,6-bis(phenylmethoxy)benzoate.
| Compound Name | [(2S)-hept-6-en-2-yl] 2-(2-oxobut-3-enyl)-4,6-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 11364022 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(2S)-hept-6-en-2-yl] 2-(2-oxobut-3-enyl)-4,6-bis(phenylmethoxy)benzoate |
| SMILES | C=CCCC[C@H](C)OC(=O)c1c(CC(=O)C=C)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H34O5/c1-4-6-9-14-24(3)37-32(34)31-27(19-28(33)5-2)20-29(35-22-25-15-10-7-11-16-25)21-30(31)36-23-26-17-12-8-13-18-26/h4-5,7-8,10-13,15-18,20-21,24H,1-2,6,9,14,19,22-23H2,3H3/t24-/m0/s1 |
| InChIKey | FFFPXCJTFSYGMR-DEOSSOPVSA-N |
| XLogP | 7.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|