C25H28O4 — CID 142024815
2-[(4Z,5Z)-4-ethylideneocta-5,7-dienoxy]-6-methyl-4-phenylmethoxybenzoic acid (PubChem CID 142024815) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[(4Z,5Z)-4-ethylideneocta-5,7-dienoxy]-6-methyl-4-phenylmethoxybenzoic acid.
| Compound Name | 2-[(4Z,5Z)-4-ethylideneocta-5,7-dienoxy]-6-methyl-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 142024815 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[(4Z,5Z)-4-ethylideneocta-5,7-dienoxy]-6-methyl-4-phenylmethoxybenzoic acid |
| SMILES | C=C/C=C\C(=C/C)CCCOc1cc(OCc2ccccc2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C25H28O4/c1-4-6-11-20(5-2)14-10-15-28-23-17-22(16-19(3)24(23)25(26)27)29-18-21-12-8-7-9-13-21/h4-9,11-13,16-17H,1,10,14-15,18H2,2-3H3,(H,26,27)/b11-6-,20-5+ |
| InChIKey | ZZPSYIUQMPRFSI-OHIOGSDRSA-N |
| XLogP | 6.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|