C32H36O5 — CID 132527063
[(2R,5R)-5-phenylmethoxyoct-7-en-2-yl] 2-hydroxy-4-phenylmethoxy-5-prop-2-enylbenzoate (PubChem CID 132527063) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is [(2R,5R)-5-phenylmethoxyoct-7-en-2-yl] 2-hydroxy-4-phenylmethoxy-5-prop-2-enylbenzoate.
| Compound Name | [(2R,5R)-5-phenylmethoxyoct-7-en-2-yl] 2-hydroxy-4-phenylmethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 132527063 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [(2R,5R)-5-phenylmethoxyoct-7-en-2-yl] 2-hydroxy-4-phenylmethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)O[C@H](C)CC[C@H](CC=C)OCc2ccccc2)c(O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H36O5/c1-4-12-27-20-29(30(33)21-31(27)36-23-26-16-10-7-11-17-26)32(34)37-24(3)18-19-28(13-5-2)35-22-25-14-8-6-9-15-25/h4-11,14-17,20-21,24,28,33H,1-2,12-13,18-19,22-23H2,3H3/t24-,28+/m1/s1 |
| InChIKey | ITAYQTPMONVRCB-YWEHKCAJSA-N |
| XLogP | 7.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|