C26H23Cl3O5 — CID 132557168
methyl 2-[3,5-bis[(4-chlorophenyl)methoxy]-2-(3-chloropropanoyl)phenyl]acetate (PubChem CID 132557168) has the molecular formula C26H23Cl3O5 and a molecular weight of 521.82 g/mol. Its IUPAC name is methyl 2-[3,5-bis[(4-chlorophenyl)methoxy]-2-(3-chloropropanoyl)phenyl]acetate.
| Compound Name | methyl 2-[3,5-bis[(4-chlorophenyl)methoxy]-2-(3-chloropropanoyl)phenyl]acetate |
|---|---|
| PubChem CID | 132557168 |
| Molecular Formula | C26H23Cl3O5 |
| Molecular Weight | 521.82 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | methyl 2-[3,5-bis[(4-chlorophenyl)methoxy]-2-(3-chloropropanoyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(OCc2ccc(Cl)cc2)cc(OCc2ccc(Cl)cc2)c1C(=O)CCCl |
| InChI | InChI=1S/C26H23Cl3O5/c1-32-25(31)13-19-12-22(33-15-17-2-6-20(28)7-3-17)14-24(26(19)23(30)10-11-27)34-16-18-4-8-21(29)9-5-18/h2-9,12,14H,10-11,13,15-16H2,1H3 |
| InChIKey | ITEARNIFFJRIQI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.82 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|