C22H26ClNO4 — CID 68844211
methyl 2-[4-[(4-chlorophenyl)methoxy]-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]acetate (PubChem CID 68844211) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is methyl 2-[4-[(4-chlorophenyl)methoxy]-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[(4-chlorophenyl)methoxy]-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 68844211 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl 2-[4-[(4-chlorophenyl)methoxy]-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCc2ccc(Cl)cc2)c(CN2CCC(O)CC2)c1 |
| InChI | InChI=1S/C22H26ClNO4/c1-27-22(26)13-17-4-7-21(28-15-16-2-5-19(23)6-3-16)18(12-17)14-24-10-8-20(25)9-11-24/h2-7,12,20,25H,8-11,13-15H2,1H3 |
| InChIKey | NNNMOYJDEMENIW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |