C20H30N2O5 — CID 68843420
4-[[5-(2-methoxy-2-oxoethyl)-2-(3-methylbutoxy)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 68843420) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[[5-(2-methoxy-2-oxoethyl)-2-(3-methylbutoxy)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[5-(2-methoxy-2-oxoethyl)-2-(3-methylbutoxy)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68843420 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-[[5-(2-methoxy-2-oxoethyl)-2-(3-methylbutoxy)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | COC(=O)Cc1ccc(OCCC(C)C)c(CN2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C20H30N2O5/c1-15(2)6-11-27-18-5-4-16(13-19(23)26-3)12-17(18)14-21-7-9-22(10-8-21)20(24)25/h4-5,12,15H,6-11,13-14H2,1-3H3,(H,24,25) |
| InChIKey | SEZCRPYCJOFYKF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |