C18H28N2O2 — CID 176931156
N-methyl-1-[[3-methyl-4-(3-methylbutoxy)phenyl]methyl]azetidine-3-carboxamide (PubChem CID 176931156) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-methyl-1-[[3-methyl-4-(3-methylbutoxy)phenyl]methyl]azetidine-3-carboxamide.
| Compound Name | N-methyl-1-[[3-methyl-4-(3-methylbutoxy)phenyl]methyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 176931156 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-methyl-1-[[3-methyl-4-(3-methylbutoxy)phenyl]methyl]azetidine-3-carboxamide |
| SMILES | CNC(=O)C1CN(Cc2ccc(OCCC(C)C)c(C)c2)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-13(2)7-8-22-17-6-5-15(9-14(17)3)10-20-11-16(12-20)18(21)19-4/h5-6,9,13,16H,7-8,10-12H2,1-4H3,(H,19,21) |
| InChIKey | XABXKOMHIRREEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |