C18H28N2O2 — CID 176930441
1-[(4-butoxyphenyl)methyl]-N-methylazetidine-3-carboxamide;ethene (PubChem CID 176930441) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[(4-butoxyphenyl)methyl]-N-methylazetidine-3-carboxamide;ethene.
| Compound Name | 1-[(4-butoxyphenyl)methyl]-N-methylazetidine-3-carboxamide;ethene |
|---|---|
| PubChem CID | 176930441 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(4-butoxyphenyl)methyl]-N-methylazetidine-3-carboxamide;ethene |
| SMILES | C=C.CCCCOc1ccc(CN2CC(C(=O)NC)C2)cc1 |
| InChI | InChI=1S/C16H24N2O2.C2H4/c1-3-4-9-20-15-7-5-13(6-8-15)10-18-11-14(12-18)16(19)17-2;1-2/h5-8,14H,3-4,9-12H2,1-2H3,(H,17,19);1-2H2 |
| InChIKey | FZAGCFGYDSWOBD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|