C17H27NO4 — CID 166834208
(3R,5S)-1-[(4-pentoxyphenyl)methyl]piperidine-3,4,5-triol (PubChem CID 166834208) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3R,5S)-1-[(4-pentoxyphenyl)methyl]piperidine-3,4,5-triol.
| Compound Name | (3R,5S)-1-[(4-pentoxyphenyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166834208 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (3R,5S)-1-[(4-pentoxyphenyl)methyl]piperidine-3,4,5-triol |
| SMILES | CCCCCOc1ccc(CN2C[C@@H](O)C(O)[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C17H27NO4/c1-2-3-4-9-22-14-7-5-13(6-8-14)10-18-11-15(19)17(21)16(20)12-18/h5-8,15-17,19-21H,2-4,9-12H2,1H3/t15-,16+,17? |
| InChIKey | DJCLPMMAKUKRJX-SJPCQFCGSA-N |
| XLogP | 1.15 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|