C16H23F2NO4 — CID 166834298
(3S,5R)-1-[(4-butoxy-2,6-difluorophenyl)methyl]piperidine-3,4,5-triol (PubChem CID 166834298) has the molecular formula C16H23F2NO4 and a molecular weight of 331.36 g/mol. Its IUPAC name is (3S,5R)-1-[(4-butoxy-2,6-difluorophenyl)methyl]piperidine-3,4,5-triol.
| Compound Name | (3S,5R)-1-[(4-butoxy-2,6-difluorophenyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166834298 |
| Molecular Formula | C16H23F2NO4 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3S,5R)-1-[(4-butoxy-2,6-difluorophenyl)methyl]piperidine-3,4,5-triol |
| SMILES | CCCCOc1cc(F)c(CN2C[C@@H](O)C(O)[C@@H](O)C2)c(F)c1 |
| InChI | InChI=1S/C16H23F2NO4/c1-2-3-4-23-10-5-12(17)11(13(18)6-10)7-19-8-14(20)16(22)15(21)9-19/h5-6,14-16,20-22H,2-4,7-9H2,1H3/t14-,15+,16? |
| InChIKey | CUNWGBDXVALNMI-XYPWUTKMSA-N |
| XLogP | 1.04 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|