C12H14F2O2 — CID 171735695
2-(4-butoxy-3,5-difluorophenyl)oxirane (PubChem CID 171735695) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(4-butoxy-3,5-difluorophenyl)oxirane.
| Compound Name | 2-(4-butoxy-3,5-difluorophenyl)oxirane |
|---|---|
| PubChem CID | 171735695 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(4-butoxy-3,5-difluorophenyl)oxirane |
| SMILES | CCCCOc1c(F)cc(C2CO2)cc1F |
| InChI | InChI=1S/C12H14F2O2/c1-2-3-4-15-12-9(13)5-8(6-10(12)14)11-7-16-11/h5-6,11H,2-4,7H2,1H3 |
| InChIKey | KLPKBSXCJKTXBI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|