C13H17BF2O3 — CID 159550867
2-(3,5-difluoro-4-hexoxyphenyl)-1,3,2-dioxaboretane (PubChem CID 159550867) has the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-hexoxyphenyl)-1,3,2-dioxaboretane.
| Compound Name | 2-(3,5-difluoro-4-hexoxyphenyl)-1,3,2-dioxaboretane |
|---|---|
| PubChem CID | 159550867 |
| Molecular Formula | C13H17BF2O3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(3,5-difluoro-4-hexoxyphenyl)-1,3,2-dioxaboretane |
| SMILES | CCCCCCOc1c(F)cc(B2OCO2)cc1F |
| InChI | InChI=1S/C13H17BF2O3/c1-2-3-4-5-6-17-13-11(15)7-10(8-12(13)16)14-18-9-19-14/h7-8H,2-6,9H2,1H3 |
| InChIKey | MFJIWIPPXIKIQT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|